N-(3-ethylphenyl)-1-methyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-(3-ethylphenyl)-1-methyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
N-(3-ethylphenyl)-1-methyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | G636-1322 |
| Compound Name: | N-(3-ethylphenyl)-1-methyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 389.52 |
| Molecular Formula: | C20 H27 N3 O3 S |
| Smiles: | CCc1cccc(c1)NC(c1cc(cn1C)S(N1CCC(C)CC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5723 |
| logD: | 3.5721 |
| logSw: | -3.6769 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.35 |
| InChI Key: | UAKORQITDUGZPZ-UHFFFAOYSA-N |