N-[(2-ethoxyphenyl)methyl]-1-{3-methyl-5-[2-(4-methylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(2-ethoxyphenyl)methyl]-1-{3-methyl-5-[2-(4-methylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
N-[(2-ethoxyphenyl)methyl]-1-{3-methyl-5-[2-(4-methylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G637-0714 |
| Compound Name: | N-[(2-ethoxyphenyl)methyl]-1-{3-methyl-5-[2-(4-methylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide |
| Molecular Weight: | 523.65 |
| Molecular Formula: | C28 H33 N3 O5 S |
| Smiles: | CCOc1ccccc1CNC(C1CCN(CC1)S(c1c(C)noc1/C=C/c1ccc(C)cc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2699 |
| logD: | 4.2699 |
| logSw: | -4.1147 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.089 |
| InChI Key: | VBQAIJHAPZFIRO-UHFFFAOYSA-N |