N-(3-chloro-4-fluorophenyl)-1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
N-(3-chloro-4-fluorophenyl)-1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G637-1016 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide |
| Molecular Weight: | 521.97 |
| Molecular Formula: | C24 H22 Cl F2 N3 O4 S |
| Smiles: | Cc1c(c(/C=C/c2ccccc2F)on1)S(N1CCC(CC1)C(Nc1ccc(c(c1)[Cl])F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3337 |
| logD: | 4.2923 |
| logSw: | -4.4729 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.556 |
| InChI Key: | VORIRVRACYEGBV-UHFFFAOYSA-N |