1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-(6-methyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-(6-methyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-(6-methyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G637-1026 |
| Compound Name: | 1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-(6-methyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
| Molecular Weight: | 540.63 |
| Molecular Formula: | C26 H25 F N4 O4 S2 |
| Smiles: | Cc1ccc2c(c1)sc(NC(C1CCN(CC1)S(c1c(C)noc1/C=C/c1ccccc1F)(=O)=O)=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 4.9403 |
| logD: | 4.9401 |
| logSw: | -4.5861 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.317 |
| InChI Key: | PDPXTOPNGBTGCL-UHFFFAOYSA-N |