N-(2,5-dimethoxyphenyl)-1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
N-(2,5-dimethoxyphenyl)-1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G637-1376 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidine-4-carboxamide |
| Molecular Weight: | 553.68 |
| Molecular Formula: | C29 H35 N3 O6 S |
| Smiles: | Cc1cc(C)c(/C=C/c2c(c(C)no2)S(N2CCC(CC2)C(Nc2cc(ccc2OC)OC)=O)(=O)=O)c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.7684 |
| logD: | 4.766 |
| logSw: | -4.4862 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 91.033 |
| InChI Key: | GXKSHTRRBMFVIR-UHFFFAOYSA-N |