(1-{5-[2-(2,4-difluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(2,3-dihydro-4H-1,4-benzothiazin-4-yl)methanone
Chemical Structure Depiction of
(1-{5-[2-(2,4-difluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(2,3-dihydro-4H-1,4-benzothiazin-4-yl)methanone
(1-{5-[2-(2,4-difluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(2,3-dihydro-4H-1,4-benzothiazin-4-yl)methanone
Compound characteristics
| Compound ID: | G637-3611 |
| Compound Name: | (1-{5-[2-(2,4-difluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(2,3-dihydro-4H-1,4-benzothiazin-4-yl)methanone |
| Molecular Weight: | 545.63 |
| Molecular Formula: | C26 H25 F2 N3 O4 S2 |
| Smiles: | Cc1c(c(/C=C/c2ccc(cc2F)F)on1)S(N1CCC(CC1)C(N1CCSc2ccccc12)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2319 |
| logD: | 4.2319 |
| logSw: | -4.2333 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 68.778 |
| InChI Key: | QMTDKYIRVKONSW-UHFFFAOYSA-N |