1-[2-(2,4-dimethoxyphenyl)-2-methyl-5-(3-methylphenyl)-1,3,4-oxadiazol-3(2H)-yl]ethan-1-one
Chemical Structure Depiction of
1-[2-(2,4-dimethoxyphenyl)-2-methyl-5-(3-methylphenyl)-1,3,4-oxadiazol-3(2H)-yl]ethan-1-one
1-[2-(2,4-dimethoxyphenyl)-2-methyl-5-(3-methylphenyl)-1,3,4-oxadiazol-3(2H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | G642-0143 |
| Compound Name: | 1-[2-(2,4-dimethoxyphenyl)-2-methyl-5-(3-methylphenyl)-1,3,4-oxadiazol-3(2H)-yl]ethan-1-one |
| Molecular Weight: | 354.4 |
| Molecular Formula: | C20 H22 N2 O4 |
| Smiles: | CC(N1C(C)(c2ccc(cc2OC)OC)OC(c2cccc(C)c2)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.69 |
| logD: | 3.69 |
| logSw: | -4.0824 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.557 |
| InChI Key: | NXUABKUZUFQPPC-FQEVSTJZSA-N |