2-[3-acetyl-5-(3-bromophenyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl acetate
Chemical Structure Depiction of
2-[3-acetyl-5-(3-bromophenyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl acetate
2-[3-acetyl-5-(3-bromophenyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl acetate
Compound characteristics
| Compound ID: | G642-1757 |
| Compound Name: | 2-[3-acetyl-5-(3-bromophenyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl acetate |
| Molecular Weight: | 433.26 |
| Molecular Formula: | C19 H17 Br N2 O5 |
| Smiles: | CC(N1C(c2cc(ccc2OC(C)=O)OC)OC(c2cccc(c2)[Br])=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6731 |
| logD: | 3.6731 |
| logSw: | -4.1023 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.633 |
| InChI Key: | DKANQBITIGMNOH-LJQANCHMSA-N |