1-[4-acetyl-5-(3-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazol-2-yl]naphthalen-2-yl acetate
Chemical Structure Depiction of
1-[4-acetyl-5-(3-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazol-2-yl]naphthalen-2-yl acetate
1-[4-acetyl-5-(3-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazol-2-yl]naphthalen-2-yl acetate
Compound characteristics
| Compound ID: | G642-7243 |
| Compound Name: | 1-[4-acetyl-5-(3-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazol-2-yl]naphthalen-2-yl acetate |
| Molecular Weight: | 392.39 |
| Molecular Formula: | C22 H17 F N2 O4 |
| Smiles: | CC(N1C(c2cccc(c2)F)OC(c2c(ccc3ccccc23)OC(C)=O)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8234 |
| logD: | 3.8234 |
| logSw: | -4.4013 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 55.817 |
| InChI Key: | BFEFLRRXLWSFCV-QFIPXVFZSA-N |