6-ethyl-5-methyl-N-[3-(trifluoromethyl)phenyl][1,2,4]triazolo[1,5-a]pyrimidin-7-amine
					Chemical Structure Depiction of
6-ethyl-5-methyl-N-[3-(trifluoromethyl)phenyl][1,2,4]triazolo[1,5-a]pyrimidin-7-amine
			6-ethyl-5-methyl-N-[3-(trifluoromethyl)phenyl][1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | G644-0155 | 
| Compound Name: | 6-ethyl-5-methyl-N-[3-(trifluoromethyl)phenyl][1,2,4]triazolo[1,5-a]pyrimidin-7-amine | 
| Molecular Weight: | 321.3 | 
| Molecular Formula: | C15 H14 F3 N5 | 
| Smiles: | CCc1c(C)nc2ncnn2c1Nc1cccc(c1)C(F)(F)F | 
| Stereo: | ACHIRAL | 
| logP: | 3.9446 | 
| logD: | 3.9372 | 
| logSw: | -4.0696 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 40.901 | 
| InChI Key: | JSCSEAYDGHFDHO-UHFFFAOYSA-N | 
 
				 
				