3,4-dimethoxy-N-(3-methyl-2-oxo-2,3-dihydro-1,3-benzothiazol-6-yl)benzamide
Chemical Structure Depiction of
3,4-dimethoxy-N-(3-methyl-2-oxo-2,3-dihydro-1,3-benzothiazol-6-yl)benzamide
3,4-dimethoxy-N-(3-methyl-2-oxo-2,3-dihydro-1,3-benzothiazol-6-yl)benzamide
Compound characteristics
| Compound ID: | G645-0031 |
| Compound Name: | 3,4-dimethoxy-N-(3-methyl-2-oxo-2,3-dihydro-1,3-benzothiazol-6-yl)benzamide |
| Molecular Weight: | 344.39 |
| Molecular Formula: | C17 H16 N2 O4 S |
| Smiles: | CN1C(=O)Sc2cc(ccc12)NC(c1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8859 |
| logD: | 2.8859 |
| logSw: | -3.6678 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.201 |
| InChI Key: | WPIUQOCZMCTMPL-UHFFFAOYSA-N |