N-(3-chloro-4-methylphenyl)-2-[7-fluoro-6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1(4H)-yl]acetamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-[7-fluoro-6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1(4H)-yl]acetamide
N-(3-chloro-4-methylphenyl)-2-[7-fluoro-6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1(4H)-yl]acetamide
Compound characteristics
| Compound ID: | G646-0967 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-[7-fluoro-6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1(4H)-yl]acetamide |
| Molecular Weight: | 463.89 |
| Molecular Formula: | C25 H19 Cl F N3 O3 |
| Smiles: | Cc1cc2C(C(=CN(CC(Nc3ccc(C)c(c3)[Cl])=O)c2cc1F)C(c1ccncc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6455 |
| logD: | 4.6453 |
| logSw: | -4.7786 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.607 |
| InChI Key: | DPLONMHVOIWOBH-UHFFFAOYSA-N |