N-(2,6-dimethylphenyl)-4-hydroxy-2-oxo-1-phenyl-1,2-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-4-hydroxy-2-oxo-1-phenyl-1,2-dihydroquinoline-3-carboxamide
N-(2,6-dimethylphenyl)-4-hydroxy-2-oxo-1-phenyl-1,2-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | G650-0537 |
| Compound Name: | N-(2,6-dimethylphenyl)-4-hydroxy-2-oxo-1-phenyl-1,2-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C24 H20 N2 O3 |
| Smiles: | Cc1cccc(C)c1NC(C1=C(c2ccccc2N(C1=O)c1ccccc1)O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2603 |
| logD: | -0.9014 |
| logSw: | -3.5741 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.496 |
| InChI Key: | JHOLVCQYVJKXGV-UHFFFAOYSA-N |