2-[(3-fluorophenyl)methyl]-5,6-dimethyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
2-[(3-fluorophenyl)methyl]-5,6-dimethyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
2-[(3-fluorophenyl)methyl]-5,6-dimethyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | G652-4624 |
| Compound Name: | 2-[(3-fluorophenyl)methyl]-5,6-dimethyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 361.42 |
| Molecular Formula: | C21 H20 F N5 |
| Smiles: | Cc1ccc(cc1)Nc1c(C)c(C)nc2nc(Cc3cccc(c3)F)nn12 |
| Stereo: | ACHIRAL |
| logP: | 4.7952 |
| logD: | 4.7895 |
| logSw: | -4.6338 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.679 |
| InChI Key: | GLLSRXUGGXVPJD-UHFFFAOYSA-N |