7-benzyl-2-(3,4-dimethylphenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide
Chemical Structure Depiction of
7-benzyl-2-(3,4-dimethylphenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide
7-benzyl-2-(3,4-dimethylphenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide
Compound characteristics
| Compound ID: | G656-0772 |
| Compound Name: | 7-benzyl-2-(3,4-dimethylphenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide |
| Molecular Weight: | 467.5 |
| Molecular Formula: | C27 H22 F N5 O2 |
| Smiles: | Cc1ccc(cc1C)c1nc(C(N)=O)c2c(n1)N(C(N2Cc1ccccc1)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 6.1714 |
| logD: | 6.1714 |
| logSw: | -5.5205 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.806 |
| InChI Key: | JMVCUFQQILIDRO-UHFFFAOYSA-N |