2-(3-bromophenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide
Chemical Structure Depiction of
2-(3-bromophenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide
2-(3-bromophenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide
Compound characteristics
| Compound ID: | G656-0794 |
| Compound Name: | 2-(3-bromophenyl)-9-(4-fluorophenyl)-8-oxo-8,9-dihydro-7H-purine-6-carboxamide |
| Molecular Weight: | 428.22 |
| Molecular Formula: | C18 H11 Br F N5 O2 |
| Smiles: | [H]N1C(N(c2ccc(cc2)F)c2c1c(C(N)=O)nc(c1cccc(c1)[Br])n2)=O |
| Stereo: | ACHIRAL |
| logP: | 3.823 |
| logD: | 3.7854 |
| logSw: | -4.2083 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 78.61 |
| InChI Key: | BOVBHHMSXBSALC-UHFFFAOYSA-N |