2-(4-oxo-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-3(4H)-yl)-N-(2,4,6-trimethylphenyl)butanamide
Chemical Structure Depiction of
2-(4-oxo-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-3(4H)-yl)-N-(2,4,6-trimethylphenyl)butanamide
2-(4-oxo-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-3(4H)-yl)-N-(2,4,6-trimethylphenyl)butanamide
Compound characteristics
| Compound ID: | G663-0838 |
| Compound Name: | 2-(4-oxo-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-3(4H)-yl)-N-(2,4,6-trimethylphenyl)butanamide |
| Molecular Weight: | 404.51 |
| Molecular Formula: | C24 H28 N4 O2 |
| Smiles: | CCC(C(Nc1c(C)cc(C)cc1C)=O)N1C=Nc2c(cc3CCCCc3n2)C1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1578 |
| logD: | 4.1577 |
| logSw: | -4.0776 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.01 |
| InChI Key: | NKYWLOQVWNPYQJ-FQEVSTJZSA-N |