6-bromo-N-[(4-chlorophenyl)methyl]-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
6-bromo-N-[(4-chlorophenyl)methyl]-2H-1-benzopyran-3-carboxamide
6-bromo-N-[(4-chlorophenyl)methyl]-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | G669-1098 |
| Compound Name: | 6-bromo-N-[(4-chlorophenyl)methyl]-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 378.65 |
| Molecular Formula: | C17 H13 Br Cl N O2 |
| Smiles: | C(c1ccc(cc1)[Cl])NC(C1COc2ccc(cc2C=1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.5504 |
| logD: | 4.5504 |
| logSw: | -4.6559 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.022 |
| InChI Key: | GLVHLFUMXUYUFI-UHFFFAOYSA-N |