6-bromo-N-(3,4,5-trimethoxyphenyl)-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
6-bromo-N-(3,4,5-trimethoxyphenyl)-2H-1-benzopyran-3-carboxamide
6-bromo-N-(3,4,5-trimethoxyphenyl)-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | G669-1130 |
| Compound Name: | 6-bromo-N-(3,4,5-trimethoxyphenyl)-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 420.26 |
| Molecular Formula: | C19 H18 Br N O5 |
| Smiles: | COc1cc(cc(c1OC)OC)NC(C1COc2ccc(cc2C=1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.6392 |
| logD: | 3.6389 |
| logSw: | -3.8996 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.678 |
| InChI Key: | BDXYJOXTIPMMCA-UHFFFAOYSA-N |