4-tert-butyl-N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
4-tert-butyl-N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methylbenzene-1-sulfonamide
4-tert-butyl-N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G671-0178 |
| Compound Name: | 4-tert-butyl-N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methylbenzene-1-sulfonamide |
| Molecular Weight: | 377.55 |
| Molecular Formula: | C20 H31 N3 O2 S |
| Smiles: | CCn1c(C)c(CCN(C)S(c2ccc(cc2)C(C)(C)C)(=O)=O)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.226 |
| logD: | 4.2254 |
| logSw: | -4.1077 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.059 |
| InChI Key: | HWYPNHCKSJMGKA-UHFFFAOYSA-N |