N-(3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide
N-(3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide
Compound characteristics
| Compound ID: | G677-0139 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| Molecular Weight: | 411.45 |
| Molecular Formula: | C21 H18 F N3 O3 S |
| Smiles: | Cc1c(C(Nc2cc(cc(c2)OC)OC)=O)sc2nc(cn12)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 4.6026 |
| logD: | 4.6007 |
| logSw: | -4.2984 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.621 |
| InChI Key: | CRAQTVXTMTVJQK-UHFFFAOYSA-N |