6-(4-fluorophenyl)-3-methyl-N-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide
Chemical Structure Depiction of
6-(4-fluorophenyl)-3-methyl-N-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide
6-(4-fluorophenyl)-3-methyl-N-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide
Compound characteristics
| Compound ID: | G677-0141 |
| Compound Name: | 6-(4-fluorophenyl)-3-methyl-N-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C20 H16 F N3 O S |
| Smiles: | Cc1ccc(cc1)NC(c1c(C)n2cc(c3ccc(cc3)F)nc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8869 |
| logD: | 4.8868 |
| logSw: | -4.4666 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.533 |
| InChI Key: | BCJGJTADQRDKLJ-UHFFFAOYSA-N |