[4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrazol-1-yl](3-fluorophenyl)methanone
Chemical Structure Depiction of
[4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrazol-1-yl](3-fluorophenyl)methanone
[4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrazol-1-yl](3-fluorophenyl)methanone
Compound characteristics
| Compound ID: | G680-0211 |
| Compound Name: | [4-(azepane-1-sulfonyl)-3,5-dimethyl-1H-pyrazol-1-yl](3-fluorophenyl)methanone |
| Molecular Weight: | 379.45 |
| Molecular Formula: | C18 H22 F N3 O3 S |
| Smiles: | Cc1c(c(C)n(C(c2cccc(c2)F)=O)n1)S(N1CCCCCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1822 |
| logD: | 2.1822 |
| logSw: | -2.5358 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 59.894 |
| InChI Key: | GWRKRMFTEODOPU-UHFFFAOYSA-N |