[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl](3-fluorophenyl)methanone
Chemical Structure Depiction of
[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl](3-fluorophenyl)methanone
[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl](3-fluorophenyl)methanone
Compound characteristics
| Compound ID: | G680-0214 |
| Compound Name: | [3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl](3-fluorophenyl)methanone |
| Molecular Weight: | 379.45 |
| Molecular Formula: | C18 H22 F N3 O3 S |
| Smiles: | CC1CCN(CC1)S(c1c(C)nn(C(c2cccc(c2)F)=O)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1603 |
| logD: | 2.1603 |
| logSw: | -2.544 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 59.563 |
| InChI Key: | ZJSIRXGENZPJQG-UHFFFAOYSA-N |