[3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrazol-1-yl](4-fluorophenyl)methanone
Chemical Structure Depiction of
[3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrazol-1-yl](4-fluorophenyl)methanone
[3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrazol-1-yl](4-fluorophenyl)methanone
Compound characteristics
| Compound ID: | G680-0217 |
| Compound Name: | [3,5-dimethyl-4-(morpholine-4-sulfonyl)-1H-pyrazol-1-yl](4-fluorophenyl)methanone |
| Molecular Weight: | 367.4 |
| Molecular Formula: | C16 H18 F N3 O4 S |
| Smiles: | Cc1c(c(C)n(C(c2ccc(cc2)F)=O)n1)S(N1CCOCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.6872 |
| logD: | 0.6872 |
| logSw: | -2.0849 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 67.472 |
| InChI Key: | FACYNSWECIPGGS-UHFFFAOYSA-N |