N,N-diethyl-3,5-dimethyl-1-[(4-methylphenoxy)acetyl]-1H-pyrazole-4-sulfonamide
Chemical Structure Depiction of
N,N-diethyl-3,5-dimethyl-1-[(4-methylphenoxy)acetyl]-1H-pyrazole-4-sulfonamide
N,N-diethyl-3,5-dimethyl-1-[(4-methylphenoxy)acetyl]-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | G680-0355 |
| Compound Name: | N,N-diethyl-3,5-dimethyl-1-[(4-methylphenoxy)acetyl]-1H-pyrazole-4-sulfonamide |
| Molecular Weight: | 379.48 |
| Molecular Formula: | C18 H25 N3 O4 S |
| Smiles: | CCN(CC)S(c1c(C)nn(C(COc2ccc(C)cc2)=O)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6294 |
| logD: | 1.6294 |
| logSw: | -2.425 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.92 |
| InChI Key: | XDVRWWFNJQBMAR-UHFFFAOYSA-N |