1-[3-(dimethylsulfamoyl)benzoyl]-N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Chemical Structure Depiction of
1-[3-(dimethylsulfamoyl)benzoyl]-N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide
1-[3-(dimethylsulfamoyl)benzoyl]-N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | G680-0487 |
| Compound Name: | 1-[3-(dimethylsulfamoyl)benzoyl]-N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| Molecular Weight: | 442.55 |
| Molecular Formula: | C18 H26 N4 O5 S2 |
| Smiles: | CCN(CC)S(c1c(C)nn(C(c2cccc(c2)S(N(C)C)(=O)=O)=O)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.809 |
| logD: | 0.809 |
| logSw: | -2.2319 |
| Hydrogen bond acceptors count: | 13 |
| Polar surface area: | 92.612 |
| InChI Key: | KRJCEVJXAUOQTM-UHFFFAOYSA-N |