N,N-diethyl-1-(4-methoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Chemical Structure Depiction of
N,N-diethyl-1-(4-methoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
N,N-diethyl-1-(4-methoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | G680-0563 |
| Compound Name: | N,N-diethyl-1-(4-methoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| Molecular Weight: | 401.5 |
| Molecular Formula: | C16 H23 N3 O5 S2 |
| Smiles: | CCN(CC)S(c1c(C)nn(c1C)S(c1ccc(cc1)OC)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5046 |
| logD: | 1.5046 |
| logSw: | -2.4075 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 79.499 |
| InChI Key: | JXVWHPHTFSGUNA-UHFFFAOYSA-N |