N,N-diethyl-1-(4-methoxy-3-methylbenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
					Chemical Structure Depiction of
N,N-diethyl-1-(4-methoxy-3-methylbenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
			N,N-diethyl-1-(4-methoxy-3-methylbenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | G680-0581 | 
| Compound Name: | N,N-diethyl-1-(4-methoxy-3-methylbenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide | 
| Molecular Weight: | 415.53 | 
| Molecular Formula: | C17 H25 N3 O5 S2 | 
| Smiles: | CCN(CC)S(c1c(C)nn(c1C)S(c1ccc(c(C)c1)OC)(=O)=O)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.9756 | 
| logD: | 1.9756 | 
| logSw: | -2.5176 | 
| Hydrogen bond acceptors count: | 11 | 
| Polar surface area: | 79.586 | 
| InChI Key: | XETCRBSZRWSLRF-UHFFFAOYSA-N | 
 
				 
				