1-[1-(4-ethoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl]-4-methylpiperidine
Chemical Structure Depiction of
1-[1-(4-ethoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl]-4-methylpiperidine
1-[1-(4-ethoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl]-4-methylpiperidine
Compound characteristics
| Compound ID: | G680-0659 |
| Compound Name: | 1-[1-(4-ethoxybenzene-1-sulfonyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl]-4-methylpiperidine |
| Molecular Weight: | 441.57 |
| Molecular Formula: | C19 H27 N3 O5 S2 |
| Smiles: | CCOc1ccc(cc1)S(n1c(C)c(c(C)n1)S(N1CCC(C)CC1)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5382 |
| logD: | 2.5382 |
| logSw: | -2.6524 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 79.693 |
| InChI Key: | OVXPMQPFOLPDLZ-UHFFFAOYSA-N |