1-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-N-(2-fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
1-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-N-(2-fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide
1-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-N-(2-fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | G684-0111 |
| Compound Name: | 1-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-N-(2-fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 451.46 |
| Molecular Formula: | C23 H22 F N5 O4 |
| Smiles: | Cc1c(C(Nc2ccccc2F)=O)nnn1Cc1c(C)oc(c2cccc(c2OC)OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.0886 |
| logD: | 3.0814 |
| logSw: | -3.5932 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.808 |
| InChI Key: | FJIUJPHAWZKTOH-UHFFFAOYSA-N |