N-(3,5-dimethylphenyl)-5-methyl-1-[(5-methyl-2-{4-[(propan-2-yl)oxy]phenyl}-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-5-methyl-1-[(5-methyl-2-{4-[(propan-2-yl)oxy]phenyl}-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide
N-(3,5-dimethylphenyl)-5-methyl-1-[(5-methyl-2-{4-[(propan-2-yl)oxy]phenyl}-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | G684-0229 |
| Compound Name: | N-(3,5-dimethylphenyl)-5-methyl-1-[(5-methyl-2-{4-[(propan-2-yl)oxy]phenyl}-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 459.55 |
| Molecular Formula: | C26 H29 N5 O3 |
| Smiles: | CC(C)Oc1ccc(cc1)c1nc(Cn2c(C)c(C(Nc3cc(C)cc(C)c3)=O)nn2)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.7016 |
| logD: | 4.7015 |
| logSw: | -4.3699 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.961 |
| InChI Key: | LVBGUVYOOCLZLJ-UHFFFAOYSA-N |