N-(3-fluoro-4-methylphenyl)-1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-methyl-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(3-fluoro-4-methylphenyl)-1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-methyl-1H-1,2,3-triazole-4-carboxamide
N-(3-fluoro-4-methylphenyl)-1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-methyl-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | G684-0358 |
| Compound Name: | N-(3-fluoro-4-methylphenyl)-1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-methyl-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 435.46 |
| Molecular Formula: | C23 H22 F N5 O3 |
| Smiles: | Cc1ccc(cc1F)NC(c1c(C)n(Cc2c(C)oc(c3ccccc3OC)n2)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7172 |
| logD: | 3.7081 |
| logSw: | -4.1285 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.789 |
| InChI Key: | KKHSNVGRDBZFKE-UHFFFAOYSA-N |