N-(2-chlorophenyl)-2-{[3-(thiophen-2-yl)-1,4-diazaspiro[4.4]nona-1,3-dien-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(2-chlorophenyl)-2-{[3-(thiophen-2-yl)-1,4-diazaspiro[4.4]nona-1,3-dien-2-yl]sulfanyl}acetamide
N-(2-chlorophenyl)-2-{[3-(thiophen-2-yl)-1,4-diazaspiro[4.4]nona-1,3-dien-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | G698-0206 |
| Compound Name: | N-(2-chlorophenyl)-2-{[3-(thiophen-2-yl)-1,4-diazaspiro[4.4]nona-1,3-dien-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 403.95 |
| Molecular Formula: | C19 H18 Cl N3 O S2 |
| Smiles: | C1CCC2(C1)N=C(C(=N2)SCC(Nc1ccccc1[Cl])=O)c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 3.8142 |
| logD: | 3.8141 |
| logSw: | -4.0605 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.917 |
| InChI Key: | QAPLMWDPJMQBCF-UHFFFAOYSA-N |