N-[3-(4-methylpiperazin-1-yl)propyl]-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide
Chemical Structure Depiction of
N-[3-(4-methylpiperazin-1-yl)propyl]-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide
N-[3-(4-methylpiperazin-1-yl)propyl]-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide
Compound characteristics
| Compound ID: | G706-1569 |
| Compound Name: | N-[3-(4-methylpiperazin-1-yl)propyl]-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide |
| Molecular Weight: | 406.53 |
| Molecular Formula: | C24 H30 N4 O2 |
| Smiles: | CN1CCN(CCCNC(c2ccc3c(c2)oc(CCc2ccccc2)n3)=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | 3.1798 |
| logD: | 2.0295 |
| logSw: | -3.4744 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.428 |
| InChI Key: | VCONTBCSIIFHBR-UHFFFAOYSA-N |