N-[(1-benzoyl-2,3-dihydro-1H-indol-5-yl)methyl]-N'-(3-chloro-2-methylphenyl)urea
Chemical Structure Depiction of
N-[(1-benzoyl-2,3-dihydro-1H-indol-5-yl)methyl]-N'-(3-chloro-2-methylphenyl)urea
N-[(1-benzoyl-2,3-dihydro-1H-indol-5-yl)methyl]-N'-(3-chloro-2-methylphenyl)urea
Compound characteristics
| Compound ID: | G714-0207 |
| Compound Name: | N-[(1-benzoyl-2,3-dihydro-1H-indol-5-yl)methyl]-N'-(3-chloro-2-methylphenyl)urea |
| Molecular Weight: | 419.91 |
| Molecular Formula: | C24 H22 Cl N3 O2 |
| Smiles: | Cc1c(cccc1[Cl])NC(NCc1ccc2c(CCN2C(c2ccccc2)=O)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.583 |
| logD: | 4.5829 |
| logSw: | -4.6344 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.845 |
| InChI Key: | HYENWKCIQGNYMJ-UHFFFAOYSA-N |