N-(2,5-dimethylphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea
N-(2,5-dimethylphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea
Compound characteristics
| Compound ID: | G715-1504 |
| Compound Name: | N-(2,5-dimethylphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea |
| Molecular Weight: | 383.49 |
| Molecular Formula: | C25 H25 N3 O |
| Smiles: | [H]n1cc(C(CNC(Nc2cc(C)ccc2C)=O)c2ccccc2)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1603 |
| logD: | 5.1603 |
| logSw: | -5.2247 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 42.765 |
| InChI Key: | MBHOOAMNORYBIS-OAQYLSRUSA-N |