N-(2,4-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea
					Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea
			N-(2,4-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea
Compound characteristics
| Compound ID: | G715-1547 | 
| Compound Name: | N-(2,4-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)-2-phenylethyl]urea | 
| Molecular Weight: | 415.49 | 
| Molecular Formula: | C25 H25 N3 O3 | 
| Smiles: | [H]n1cc(C(CNC(Nc2ccc(cc2OC)OC)=O)c2ccccc2)c2ccccc12 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 4.8644 | 
| logD: | 4.8643 | 
| logSw: | -4.9082 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 57.939 | 
| InChI Key: | HRXUERAFDSHCSH-HXUWFJFHSA-N | 
 
				 
				