4-cyclohexyl-N-{2-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]ethyl}benzene-1-sulfonamide
Chemical Structure Depiction of
4-cyclohexyl-N-{2-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]ethyl}benzene-1-sulfonamide
4-cyclohexyl-N-{2-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]ethyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G718-0474 |
| Compound Name: | 4-cyclohexyl-N-{2-[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]ethyl}benzene-1-sulfonamide |
| Molecular Weight: | 424.56 |
| Molecular Formula: | C23 H28 N4 O2 S |
| Smiles: | Cc1ccc(cc1)c1nc(CCNS(c2ccc(cc2)C2CCCCC2)(=O)=O)n[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 5.8183 |
| logD: | 5.8064 |
| logSw: | -5.3945 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.534 |
| InChI Key: | OBBMSHVXFDHXBM-UHFFFAOYSA-N |