4-tert-butyl-N-[2-(5-phenyl-1H-1,2,4-triazol-3-yl)ethyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-tert-butyl-N-[2-(5-phenyl-1H-1,2,4-triazol-3-yl)ethyl]benzene-1-sulfonamide
4-tert-butyl-N-[2-(5-phenyl-1H-1,2,4-triazol-3-yl)ethyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G718-0536 |
| Compound Name: | 4-tert-butyl-N-[2-(5-phenyl-1H-1,2,4-triazol-3-yl)ethyl]benzene-1-sulfonamide |
| Molecular Weight: | 384.5 |
| Molecular Formula: | C20 H24 N4 O2 S |
| Smiles: | CC(C)(C)c1ccc(cc1)S(NCCc1nc(c2ccccc2)[nH]n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7408 |
| logD: | 4.7283 |
| logSw: | -4.4831 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.614 |
| InChI Key: | KDUBRRFHTDNMKQ-UHFFFAOYSA-N |