5-chloro-N-(2-{5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl}ethyl)-2-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
5-chloro-N-(2-{5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl}ethyl)-2-methoxybenzene-1-sulfonamide
5-chloro-N-(2-{5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl}ethyl)-2-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G718-1083 |
| Compound Name: | 5-chloro-N-(2-{5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl}ethyl)-2-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 424.88 |
| Molecular Formula: | C18 H18 Cl F N4 O3 S |
| Smiles: | COc1ccc(cc1S(NCCc1nc(Cc2ccc(cc2)F)[nH]n1)(=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.428 |
| logD: | 3.4265 |
| logSw: | -3.9409 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.235 |
| InChI Key: | ZZLFJRWWBYXSRP-UHFFFAOYSA-N |