N-(3-chloro-4-methylphenyl)-2-{3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethyl-2-oxopyridin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-{3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethyl-2-oxopyridin-1(2H)-yl}acetamide
N-(3-chloro-4-methylphenyl)-2-{3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethyl-2-oxopyridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | G744-0356 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-{3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-4,6-dimethyl-2-oxopyridin-1(2H)-yl}acetamide |
| Molecular Weight: | 478.93 |
| Molecular Formula: | C25 H23 Cl N4 O4 |
| Smiles: | CC1=CC(C)=C(C(N1CC(Nc1ccc(C)c(c1)[Cl])=O)=O)c1nc(c2ccc(cc2)OC)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.7555 |
| logD: | 5.7553 |
| logSw: | -6.0072 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.526 |
| InChI Key: | JMZXSRVNMSIKPN-UHFFFAOYSA-N |