N-{[1-(3,4-dimethylphenyl)-1H-tetrazol-5-yl]methyl}-3,4-diethoxybenzamide
Chemical Structure Depiction of
N-{[1-(3,4-dimethylphenyl)-1H-tetrazol-5-yl]methyl}-3,4-diethoxybenzamide
N-{[1-(3,4-dimethylphenyl)-1H-tetrazol-5-yl]methyl}-3,4-diethoxybenzamide
Compound characteristics
| Compound ID: | G745-0041 |
| Compound Name: | N-{[1-(3,4-dimethylphenyl)-1H-tetrazol-5-yl]methyl}-3,4-diethoxybenzamide |
| Molecular Weight: | 395.46 |
| Molecular Formula: | C21 H25 N5 O3 |
| Smiles: | CCOc1ccc(cc1OCC)C(NCc1nnnn1c1ccc(C)c(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2225 |
| logD: | 3.2225 |
| logSw: | -3.1826 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.388 |
| InChI Key: | UBLKNSYKMXMFKU-UHFFFAOYSA-N |