3-(2-chlorophenyl)-5-methyl-N-[(1-phenyl-1H-tetrazol-5-yl)methyl]-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(2-chlorophenyl)-5-methyl-N-[(1-phenyl-1H-tetrazol-5-yl)methyl]-1,2-oxazole-4-carboxamide
3-(2-chlorophenyl)-5-methyl-N-[(1-phenyl-1H-tetrazol-5-yl)methyl]-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G745-0716 |
| Compound Name: | 3-(2-chlorophenyl)-5-methyl-N-[(1-phenyl-1H-tetrazol-5-yl)methyl]-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 394.82 |
| Molecular Formula: | C19 H15 Cl N6 O2 |
| Smiles: | Cc1c(C(NCc2nnnn2c2ccccc2)=O)c(c2ccccc2[Cl])no1 |
| Stereo: | ACHIRAL |
| logP: | 2.5626 |
| logD: | 2.5626 |
| logSw: | -3.5781 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.928 |
| InChI Key: | JFAARSWORHNFSF-UHFFFAOYSA-N |