N-tert-butyl-N'-{[1-(4-methylphenyl)-1H-tetrazol-5-yl]methyl}urea
Chemical Structure Depiction of
N-tert-butyl-N'-{[1-(4-methylphenyl)-1H-tetrazol-5-yl]methyl}urea
N-tert-butyl-N'-{[1-(4-methylphenyl)-1H-tetrazol-5-yl]methyl}urea
Compound characteristics
| Compound ID: | G745-1774 |
| Compound Name: | N-tert-butyl-N'-{[1-(4-methylphenyl)-1H-tetrazol-5-yl]methyl}urea |
| Molecular Weight: | 288.35 |
| Molecular Formula: | C14 H20 N6 O |
| Smiles: | Cc1ccc(cc1)n1c(CNC(NC(C)(C)C)=O)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 1.993 |
| logD: | 1.993 |
| logSw: | -2.5014 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.597 |
| InChI Key: | DGQWYPKOEUWUKV-UHFFFAOYSA-N |