N-(2,9-dimethyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl)-3-methylbenzamide
Chemical Structure Depiction of
N-(2,9-dimethyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl)-3-methylbenzamide
N-(2,9-dimethyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl)-3-methylbenzamide
Compound characteristics
| Compound ID: | G746-0228 |
| Compound Name: | N-(2,9-dimethyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl)-3-methylbenzamide |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C18 H17 N3 O2 |
| Smiles: | CC1=CC=CN2C1=NC(C)=C(C2=O)NC(c1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9894 |
| logD: | 0.2337 |
| logSw: | -2.5251 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.447 |
| InChI Key: | GHKLLBFGCMEEOR-UHFFFAOYSA-N |