2-{[(7,8-dimethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}-N-(3-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-{[(7,8-dimethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}-N-(3-methoxyphenyl)acetamide
2-{[(7,8-dimethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}-N-(3-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | G751-0829 |
| Compound Name: | 2-{[(7,8-dimethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}-N-(3-methoxyphenyl)acetamide |
| Molecular Weight: | 382.48 |
| Molecular Formula: | C21 H22 N2 O3 S |
| Smiles: | Cc1ccc2C(C=C(CSCC(Nc3cccc(c3)OC)=O)Nc2c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3781 |
| logD: | 4.3725 |
| logSw: | -4.3786 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.203 |
| InChI Key: | IRADTZDWPKOYSU-UHFFFAOYSA-N |