N-(3-chlorophenyl)-2-{[(6-ethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-{[(6-ethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}acetamide
N-(3-chlorophenyl)-2-{[(6-ethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | G751-5489 |
| Compound Name: | N-(3-chlorophenyl)-2-{[(6-ethyl-4-oxo-1,4-dihydroquinolin-2-yl)methyl]sulfanyl}acetamide |
| Molecular Weight: | 386.9 |
| Molecular Formula: | C20 H19 Cl N2 O2 S |
| Smiles: | CCc1ccc2c(c1)C(C=C(CSCC(Nc1cccc(c1)[Cl])=O)N2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4147 |
| logD: | 5.4083 |
| logSw: | -5.8556 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.911 |
| InChI Key: | ZCENVJCYVGNWNO-UHFFFAOYSA-N |