8-({[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-9-phenyl-1,9-dihydro-6H-purin-6-one
Chemical Structure Depiction of
8-({[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-9-phenyl-1,9-dihydro-6H-purin-6-one
8-({[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-9-phenyl-1,9-dihydro-6H-purin-6-one
Compound characteristics
| Compound ID: | G754-0112 |
| Compound Name: | 8-({[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}sulfanyl)-9-phenyl-1,9-dihydro-6H-purin-6-one |
| Molecular Weight: | 449.92 |
| Molecular Formula: | C22 H16 Cl N5 O2 S |
| Smiles: | Cc1c(CSc2nc3C(NC=Nc3n2c2ccccc2)=O)nc(c2ccccc2[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 4.045 |
| logD: | 4.0437 |
| logSw: | -4.3725 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.296 |
| InChI Key: | YRTKHLOZKCOENM-UHFFFAOYSA-N |