2-(4-benzyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)-N-({4-[(propan-2-yl)oxy]phenyl}methyl)acetamide
Chemical Structure Depiction of
2-(4-benzyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)-N-({4-[(propan-2-yl)oxy]phenyl}methyl)acetamide
2-(4-benzyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)-N-({4-[(propan-2-yl)oxy]phenyl}methyl)acetamide
Compound characteristics
| Compound ID: | G761-0980 |
| Compound Name: | 2-(4-benzyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)-N-({4-[(propan-2-yl)oxy]phenyl}methyl)acetamide |
| Molecular Weight: | 457.53 |
| Molecular Formula: | C27 H27 N3 O4 |
| Smiles: | CC(C)Oc1ccc(CNC(CN2C(C(N(Cc3ccccc3)c3ccccc23)=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8422 |
| logD: | 3.8422 |
| logSw: | -3.9788 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.797 |
| InChI Key: | OTHBAQRHFABHLZ-UHFFFAOYSA-N |